C25H40N2 — CID 130351791
(3E)-4-N,4-N-dicyclohexyl-2-N-(2-methylprop-2-enyl)-3-prop-1-en-2-ylhexa-1,3,5-triene-2,4-diamine (PubChem CID 130351791) has the molecular formula C25H40N2 and a molecular weight of 368.61 g/mol. Its IUPAC name is (3E)-4-N,4-N-dicyclohexyl-2-N-(2-methylprop-2-enyl)-3-prop-1-en-2-ylhexa-1,3,5-triene-2,4-diamine.
| Compound Name | (3E)-4-N,4-N-dicyclohexyl-2-N-(2-methylprop-2-enyl)-3-prop-1-en-2-ylhexa-1,3,5-triene-2,4-diamine |
|---|---|
| PubChem CID | 130351791 |
| Molecular Formula | C25H40N2 |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 368.32 |
| IUPAC Name | (3E)-4-N,4-N-dicyclohexyl-2-N-(2-methylprop-2-enyl)-3-prop-1-en-2-ylhexa-1,3,5-triene-2,4-diamine |
| SMILES | C=C/C(=C(/C(=C)C)C(=C)NCC(=C)C)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C25H40N2/c1-7-24(25(20(4)5)21(6)26-18-19(2)3)27(22-14-10-8-11-15-22)23-16-12-9-13-17-23/h7,22-23,26H,1-2,4,6,8-18H2,3,5H3/b25-24+ |
| InChIKey | FEIDKOJPPDUTGY-OCOZRVBESA-N |
| XLogP | 6.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|