C12H16F2O4 — CID 130351806
methyl 5,5-difluoro-1,6-dimethyl-3-oxo-4,6,7,7a-tetrahydro-1H-2-benzofuran-3a-carboxylate (PubChem CID 130351806) has the molecular formula C12H16F2O4 and a molecular weight of 262.25 g/mol. Its IUPAC name is methyl 5,5-difluoro-1,6-dimethyl-3-oxo-4,6,7,7a-tetrahydro-1H-2-benzofuran-3a-carboxylate.
| Compound Name | methyl 5,5-difluoro-1,6-dimethyl-3-oxo-4,6,7,7a-tetrahydro-1H-2-benzofuran-3a-carboxylate |
|---|---|
| PubChem CID | 130351806 |
| Molecular Formula | C12H16F2O4 |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | methyl 5,5-difluoro-1,6-dimethyl-3-oxo-4,6,7,7a-tetrahydro-1H-2-benzofuran-3a-carboxylate |
| SMILES | COC(=O)C12CC(F)(F)C(C)CC1C(C)OC2=O |
| InChI | InChI=1S/C12H16F2O4/c1-6-4-8-7(2)18-10(16)11(8,9(15)17-3)5-12(6,13)14/h6-8H,4-5H2,1-3H3 |
| InChIKey | AFDBQUBHJBYJHJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|