C24H16S4 — CID 130351901
4,11-bis(4-methylphenyl)-5,7,12,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),3,9(13),10-pentaene (PubChem CID 130351901) has the molecular formula C24H16S4 and a molecular weight of 432.66 g/mol. Its IUPAC name is 4,11-bis(4-methylphenyl)-5,7,12,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),3,9(13),10-pentaene.
| Compound Name | 4,11-bis(4-methylphenyl)-5,7,12,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),3,9(13),10-pentaene |
|---|---|
| PubChem CID | 130351901 |
| Molecular Formula | C24H16S4 |
| Molecular Weight | 432.66 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | 4,11-bis(4-methylphenyl)-5,7,12,14-tetrathiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),3,9(13),10-pentaene |
| SMILES | Cc1ccc(-c2cc3c(s2)sc2c4cc(-c5ccc(C)cc5)sc4sc32)cc1 |
| InChI | InChI=1S/C24H16S4/c1-13-3-7-15(8-4-13)19-11-17-21-22(27-23(17)25-19)18-12-20(26-24(18)28-21)16-9-5-14(2)6-10-16/h3-12H,1-2H3 |
| InChIKey | YOFXRFRWRPWBDL-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.66 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |