About 2,7-dimethylfuro[3,2-f]indole
2,7-dimethylfuro[3,2-f]indole (PubChem CID 130351998) has the molecular formula C12H11NO
and a molecular weight of 185.23 g/mol. Its IUPAC name is 2,7-dimethylfuro[3,2-f]indole.
Molecular Properties
| Compound Name | 2,7-dimethylfuro[3,2-f]indole |
| PubChem CID | 130351998 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 2,7-dimethylfuro[3,2-f]indole |
| SMILES | Cc1cc2cc3ccn(C)c3cc2o1 |
| InChI | InChI=1S/C12H11NO/c1-8-5-10-6-9-3-4-13(2)11(9)7-12(10)14-8/h3-7H,1-2H3 |
| InChIKey | UJPUKNGMVOQBPU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,7-dimethylfuro[3,2-f]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethylfuro[3,2-f]indole?
The IUPAC name of 2,7-dimethylfuro[3,2-f]indole (CID 130351998) is 2,7-dimethylfuro[3,2-f]indole.
What is the SMILES notation for 2,7-dimethylfuro[3,2-f]indole?
The canonical SMILES for 2,7-dimethylfuro[3,2-f]indole is Cc1cc2cc3ccn(C)c3cc2o1.
What is the InChIKey of 2,7-dimethylfuro[3,2-f]indole?
The InChIKey is UJPUKNGMVOQBPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO/c1-8-5-10-6-9-3-4-13(2)11(9)7-12(10)14-8/h3-7H,1-2H3.
What are the key properties of 2,7-dimethylfuro[3,2-f]indole?
2,7-dimethylfuro[3,2-f]indole has a molecular weight of 185.23 g/mol, XLogP of 3.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethylfuro[3,2-f]indole is sourced from PubChem (CID 130351998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).