C19H13F3N6O3S3 — CID 130352327
[4-[[5-[[4-(trifluoromethyl)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]anilino]methanesulfonic acid (PubChem CID 130352327) has the molecular formula C19H13F3N6O3S3 and a molecular weight of 526.55 g/mol. Its IUPAC name is [4-[[5-[[4-(trifluoromethyl)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]anilino]methanesulfonic acid.
| Compound Name | [4-[[5-[[4-(trifluoromethyl)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]anilino]methanesulfonic acid |
|---|---|
| PubChem CID | 130352327 |
| Molecular Formula | C19H13F3N6O3S3 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.02 |
| IUPAC Name | [4-[[5-[[4-(trifluoromethyl)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]anilino]methanesulfonic acid |
| SMILES | O=S(=O)(O)CNc1ccc(/N=N/c2nc3sc(/N=N/c4ccc(C(F)(F)F)cc4)cc3s2)cc1 |
| InChI | InChI=1S/C19H13F3N6O3S3/c20-19(21,22)11-1-3-13(4-2-11)25-27-16-9-15-17(33-16)24-18(32-15)28-26-14-7-5-12(6-8-14)23-10-34(29,30)31/h1-9,23H,10H2,(H,29,30,31)/b27-25+,28-26+ |
| InChIKey | YOEZRHZLTWKXJF-NBHCHVEOSA-N |
| XLogP | 7.46 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|