About (1R)-1-deuterio-3-fluoro-1,3-dimethylcyclopentane
(1R)-1-deuterio-3-fluoro-1,3-dimethylcyclopentane (PubChem CID 130352610) has the molecular formula C7H13F
and a molecular weight of 117.19 g/mol. Its IUPAC name is (1R)-1-deuterio-3-fluoro-1,3-dimethylcyclopentane.
Molecular Properties
| Compound Name | (1R)-1-deuterio-3-fluoro-1,3-dimethylcyclopentane |
| PubChem CID | 130352610 |
| Molecular Formula | C7H13F |
| Molecular Weight | 117.19 g/mol |
| Exact Mass | 117.11 |
| IUPAC Name | (1R)-1-deuterio-3-fluoro-1,3-dimethylcyclopentane |
| SMILES | [2H][C@@]1(C)CCC(C)(F)C1 |
| InChI | InChI=1S/C7H13F/c1-6-3-4-7(2,8)5-6/h6H,3-5H2,1-2H3/t6-,7?/m1/s1/i6D |
| InChIKey | UHBMWBFXFDXZPV-JETULELBSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1R)-1-deuterio-3-fluoro-1,3-dimethylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-deuterio-3-fluoro-1,3-dimethylcyclopentane?
The IUPAC name of (1R)-1-deuterio-3-fluoro-1,3-dimethylcyclopentane (CID 130352610) is (1R)-1-deuterio-3-fluoro-1,3-dimethylcyclopentane.
What is the SMILES notation for (1R)-1-deuterio-3-fluoro-1,3-dimethylcyclopentane?
The canonical SMILES for (1R)-1-deuterio-3-fluoro-1,3-dimethylcyclopentane is [2H][C@@]1(C)CCC(C)(F)C1.
What is the InChIKey of (1R)-1-deuterio-3-fluoro-1,3-dimethylcyclopentane?
The InChIKey is UHBMWBFXFDXZPV-JETULELBSA-N. The full InChI is InChI=1S/C7H13F/c1-6-3-4-7(2,8)5-6/h6H,3-5H2,1-2H3/t6-,7?/m1/s1/i6D.
What are the key properties of (1R)-1-deuterio-3-fluoro-1,3-dimethylcyclopentane?
(1R)-1-deuterio-3-fluoro-1,3-dimethylcyclopentane has a molecular weight of 117.19 g/mol, XLogP of 2.53, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-deuterio-3-fluoro-1,3-dimethylcyclopentane is sourced from PubChem (CID 130352610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).