About N-[3-[[(Z)-2-aminoethenyl]-propylamino]propyl]-2,2-dimethylpropanamide
N-[3-[[(Z)-2-aminoethenyl]-propylamino]propyl]-2,2-dimethylpropanamide (PubChem CID 130352670) has the molecular formula C13H27N3O
and a molecular weight of 241.38 g/mol. Its IUPAC name is N-[3-[[(Z)-2-aminoethenyl]-propylamino]propyl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[3-[[(Z)-2-aminoethenyl]-propylamino]propyl]-2,2-dimethylpropanamide |
| PubChem CID | 130352670 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | N-[3-[[(Z)-2-aminoethenyl]-propylamino]propyl]-2,2-dimethylpropanamide |
| SMILES | CCCN(/C=C\N)CCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H27N3O/c1-5-9-16(11-7-14)10-6-8-15-12(17)13(2,3)4/h7,11H,5-6,8-10,14H2,1-4H3,(H,15,17)/b11-7- |
| InChIKey | BXMMILQKNSQWQP-XFFZJAGNSA-N |
| XLogP | 1.68 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[[(Z)-2-aminoethenyl]-propylamino]propyl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[[(Z)-2-aminoethenyl]-propylamino]propyl]-2,2-dimethylpropanamide?
The IUPAC name of N-[3-[[(Z)-2-aminoethenyl]-propylamino]propyl]-2,2-dimethylpropanamide (CID 130352670) is N-[3-[[(Z)-2-aminoethenyl]-propylamino]propyl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[3-[[(Z)-2-aminoethenyl]-propylamino]propyl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[3-[[(Z)-2-aminoethenyl]-propylamino]propyl]-2,2-dimethylpropanamide is CCCN(/C=C\N)CCCNC(=O)C(C)(C)C.
What is the InChIKey of N-[3-[[(Z)-2-aminoethenyl]-propylamino]propyl]-2,2-dimethylpropanamide?
The InChIKey is BXMMILQKNSQWQP-XFFZJAGNSA-N. The full InChI is InChI=1S/C13H27N3O/c1-5-9-16(11-7-14)10-6-8-15-12(17)13(2,3)4/h7,11H,5-6,8-10,14H2,1-4H3,(H,15,17)/b11-7-.
What are the key properties of N-[3-[[(Z)-2-aminoethenyl]-propylamino]propyl]-2,2-dimethylpropanamide?
N-[3-[[(Z)-2-aminoethenyl]-propylamino]propyl]-2,2-dimethylpropanamide has a molecular weight of 241.38 g/mol, XLogP of 1.68, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[[(Z)-2-aminoethenyl]-propylamino]propyl]-2,2-dimethylpropanamide is sourced from PubChem (CID 130352670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).