C39H37N9O — CID 130352842
N-(4-methoxyphenyl)-2,3,5,6-tetramethyl-4-pyrazino[2,3-b]pyrazin-3-yl-N-(2,3,5,6-tetramethyl-4-pyrazino[2,3-b]pyrazin-3-ylphenyl)aniline (PubChem CID 130352842) has the molecular formula C39H37N9O and a molecular weight of 647.79 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2,3,5,6-tetramethyl-4-pyrazino[2,3-b]pyrazin-3-yl-N-(2,3,5,6-tetramethyl-4-pyrazino[2,3-b]pyrazin-3-ylphenyl)aniline.
| Compound Name | N-(4-methoxyphenyl)-2,3,5,6-tetramethyl-4-pyrazino[2,3-b]pyrazin-3-yl-N-(2,3,5,6-tetramethyl-4-pyrazino[2,3-b]pyrazin-3-ylphenyl)aniline |
|---|---|
| PubChem CID | 130352842 |
| Molecular Formula | C39H37N9O |
| Molecular Weight | 647.79 g/mol |
| Exact Mass | 647.31 |
| IUPAC Name | N-(4-methoxyphenyl)-2,3,5,6-tetramethyl-4-pyrazino[2,3-b]pyrazin-3-yl-N-(2,3,5,6-tetramethyl-4-pyrazino[2,3-b]pyrazin-3-ylphenyl)aniline |
| SMILES | COc1ccc(N(c2c(C)c(C)c(-c3cnc4nccnc4n3)c(C)c2C)c2c(C)c(C)c(-c3cnc4nccnc4n3)c(C)c2C)cc1 |
| InChI | InChI=1S/C39H37N9O/c1-20-24(5)34(25(6)21(2)32(20)30-18-44-36-38(46-30)42-16-14-40-36)48(28-10-12-29(49-9)13-11-28)35-26(7)22(3)33(23(4)27(35)8)31-19-45-37-39(47-31)43-17-15-41-37/h10-19H,1-9H3 |
| InChIKey | AZKJDVHWJAAISS-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 115.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.79 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |