C66H44N2O8S4 — CID 130353033
5,12-bis[4-[3,5-bis(benzenesulfonyl)phenyl]phenyl]indolo[3,2-c]carbazole (PubChem CID 130353033) has the molecular formula C66H44N2O8S4 and a molecular weight of 1121.35 g/mol. Its IUPAC name is 5,12-bis[4-[3,5-bis(benzenesulfonyl)phenyl]phenyl]indolo[3,2-c]carbazole.
| Compound Name | 5,12-bis[4-[3,5-bis(benzenesulfonyl)phenyl]phenyl]indolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 130353033 |
| Molecular Formula | C66H44N2O8S4 |
| Molecular Weight | 1121.35 g/mol |
| Exact Mass | 1120.20 |
| IUPAC Name | 5,12-bis[4-[3,5-bis(benzenesulfonyl)phenyl]phenyl]indolo[3,2-c]carbazole |
| SMILES | O=S(=O)(c1ccccc1)c1cc(-c2ccc(-n3c4ccccc4c4c3ccc3c5ccccc5n(-c5ccc(-c6cc(S(=O)(=O)c7ccccc7)cc(S(=O)(=O)c7ccccc7)c6)cc5)c34)cc2)cc(S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C66H44N2O8S4/c69-77(70,51-17-5-1-6-18-51)55-39-47(40-56(43-55)78(71,72)52-19-7-2-8-20-52)45-29-33-49(34-30-45)67-63-28-16-14-26-61(63)65-64(67)38-37-60-59-25-13-15-27-62(59)68(66(60)65)50-35-31-46(32-36-50)48-41-57(79(73,74)53-21-9-3-10-22-53)44-58(42-48)80(75,76)54-23-11-4-12-24-54/h1-44H |
| InChIKey | MMCBLOLBPPZACV-UHFFFAOYSA-N |
| XLogP | 14.55 |
| TPSA | 146.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1121.35 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |