C41H24F5N3 — CID 130353095
5-[4-[3-(2,3,4,5,6-pentafluorophenyl)phenyl]phenyl]-N,N-diphenylpyrido[4,3-b]indol-8-amine (PubChem CID 130353095) has the molecular formula C41H24F5N3 and a molecular weight of 653.65 g/mol. Its IUPAC name is 5-[4-[3-(2,3,4,5,6-pentafluorophenyl)phenyl]phenyl]-N,N-diphenylpyrido[4,3-b]indol-8-amine.
| Compound Name | 5-[4-[3-(2,3,4,5,6-pentafluorophenyl)phenyl]phenyl]-N,N-diphenylpyrido[4,3-b]indol-8-amine |
|---|---|
| PubChem CID | 130353095 |
| Molecular Formula | C41H24F5N3 |
| Molecular Weight | 653.65 g/mol |
| Exact Mass | 653.19 |
| IUPAC Name | 5-[4-[3-(2,3,4,5,6-pentafluorophenyl)phenyl]phenyl]-N,N-diphenylpyrido[4,3-b]indol-8-amine |
| SMILES | Fc1c(F)c(F)c(-c2cccc(-c3ccc(-n4c5ccncc5c5cc(N(c6ccccc6)c6ccccc6)ccc54)cc3)c2)c(F)c1F |
| InChI | InChI=1S/C41H24F5N3/c42-37-36(38(43)40(45)41(46)39(37)44)27-9-7-8-26(22-27)25-14-16-30(17-15-25)49-34-19-18-31(23-32(34)33-24-47-21-20-35(33)49)48(28-10-3-1-4-11-28)29-12-5-2-6-13-29/h1-24H |
| InChIKey | VNMUPBINOPLERR-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.65 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|