C20H22N4 — CID 130353292
N,2,3,5,6-pentamethyl-N-phenyl-4-(1,3,5-triazin-2-yl)aniline (PubChem CID 130353292) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is N,2,3,5,6-pentamethyl-N-phenyl-4-(1,3,5-triazin-2-yl)aniline.
| Compound Name | N,2,3,5,6-pentamethyl-N-phenyl-4-(1,3,5-triazin-2-yl)aniline |
|---|---|
| PubChem CID | 130353292 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | N,2,3,5,6-pentamethyl-N-phenyl-4-(1,3,5-triazin-2-yl)aniline |
| SMILES | Cc1c(C)c(N(C)c2ccccc2)c(C)c(C)c1-c1ncncn1 |
| InChI | InChI=1S/C20H22N4/c1-13-15(3)19(24(5)17-9-7-6-8-10-17)16(4)14(2)18(13)20-22-11-21-12-23-20/h6-12H,1-5H3 |
| InChIKey | HNDIFAMWMFHGLL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |