C21H13N5 — CID 130353312
5-(9H-pyrido[2,3-b]indol-2-yl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 130353312) has the molecular formula C21H13N5 and a molecular weight of 335.37 g/mol. Its IUPAC name is 5-(9H-pyrido[2,3-b]indol-2-yl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 5-(9H-pyrido[2,3-b]indol-2-yl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 130353312 |
| Molecular Formula | C21H13N5 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 5-(9H-pyrido[2,3-b]indol-2-yl)-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | c1ccc2c(c1)[nH]c1nc(-c3cc4[nH]c5ccncc5c4cn3)ccc12 |
| InChI | InChI=1S/C21H13N5/c1-2-4-16-12(3-1)13-5-6-18(26-21(13)25-16)20-9-19-15(11-23-20)14-10-22-8-7-17(14)24-19/h1-11,24H,(H,25,26) |
| InChIKey | QGSGKBGOEGEMLI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |