About 3-(9H-pyrido[2,3-b]indol-7-yl)-5H-pyrido[4,3-b]indole
3-(9H-pyrido[2,3-b]indol-7-yl)-5H-pyrido[4,3-b]indole (PubChem CID 130353330) has the molecular formula C22H14N4
and a molecular weight of 334.38 g/mol. Its IUPAC name is 3-(9H-pyrido[2,3-b]indol-7-yl)-5H-pyrido[4,3-b]indole.
Molecular Properties
| Compound Name | 3-(9H-pyrido[2,3-b]indol-7-yl)-5H-pyrido[4,3-b]indole |
| PubChem CID | 130353330 |
| Molecular Formula | C22H14N4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 3-(9H-pyrido[2,3-b]indol-7-yl)-5H-pyrido[4,3-b]indole |
| SMILES | c1ccc2c(c1)[nH]c1cc(-c3ccc4c(c3)[nH]c3ncccc34)ncc12 |
| InChI | InChI=1S/C22H14N4/c1-2-6-18-14(4-1)17-12-24-19(11-21(17)25-18)13-7-8-15-16-5-3-9-23-22(16)26-20(15)10-13/h1-12,25H,(H,23,26) |
| InChIKey | NOSWTDXZULJWRX-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(9H-pyrido[2,3-b]indol-7-yl)-5H-pyrido[4,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(9H-pyrido[2,3-b]indol-7-yl)-5H-pyrido[4,3-b]indole?
The IUPAC name of 3-(9H-pyrido[2,3-b]indol-7-yl)-5H-pyrido[4,3-b]indole (CID 130353330) is 3-(9H-pyrido[2,3-b]indol-7-yl)-5H-pyrido[4,3-b]indole.
What is the SMILES notation for 3-(9H-pyrido[2,3-b]indol-7-yl)-5H-pyrido[4,3-b]indole?
The canonical SMILES for 3-(9H-pyrido[2,3-b]indol-7-yl)-5H-pyrido[4,3-b]indole is c1ccc2c(c1)[nH]c1cc(-c3ccc4c(c3)[nH]c3ncccc34)ncc12.
What is the InChIKey of 3-(9H-pyrido[2,3-b]indol-7-yl)-5H-pyrido[4,3-b]indole?
The InChIKey is NOSWTDXZULJWRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14N4/c1-2-6-18-14(4-1)17-12-24-19(11-21(17)25-18)13-7-8-15-16-5-3-9-23-22(16)26-20(15)10-13/h1-12,25H,(H,23,26).
What are the key properties of 3-(9H-pyrido[2,3-b]indol-7-yl)-5H-pyrido[4,3-b]indole?
3-(9H-pyrido[2,3-b]indol-7-yl)-5H-pyrido[4,3-b]indole has a molecular weight of 334.38 g/mol, XLogP of 5.41, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(9H-pyrido[2,3-b]indol-7-yl)-5H-pyrido[4,3-b]indole is sourced from PubChem (CID 130353330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).