C37H45N2O+ — CID 130353455
17-ethyl-6,7,7,9,19,19,20-heptamethyl-13-(3-propan-2-ylphenyl)-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaene (PubChem CID 130353455) has the molecular formula C37H45N2O+ and a molecular weight of 533.78 g/mol. Its IUPAC name is 17-ethyl-6,7,7,9,19,19,20-heptamethyl-13-(3-propan-2-ylphenyl)-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaene.
| Compound Name | 17-ethyl-6,7,7,9,19,19,20-heptamethyl-13-(3-propan-2-ylphenyl)-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaene |
|---|---|
| PubChem CID | 130353455 |
| Molecular Formula | C37H45N2O+ |
| Molecular Weight | 533.78 g/mol |
| Exact Mass | 533.35 |
| IUPAC Name | 17-ethyl-6,7,7,9,19,19,20-heptamethyl-13-(3-propan-2-ylphenyl)-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaene |
| SMILES | CCC1CC(C)(C)N(C)c2cc3c(cc21)C(c1cccc(C(C)C)c1)=c1cc2c(cc1O3)=[N+](C)C(C)(C)C=C2C |
| InChI | InChI=1S/C37H45N2O/c1-11-24-21-37(7,8)39(10)32-19-34-30(17-28(24)32)35(26-14-12-13-25(15-26)22(2)3)29-16-27-23(4)20-36(5,6)38(9)31(27)18-33(29)40-34/h12-20,22,24H,11,21H2,1-10H3/q+1 |
| InChIKey | MGGQRQUFXNZMRD-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.78 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|