C56H46N2O2S — CID 130353621
3,7-bis[4-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2,3-dimethylphenyl]dibenzothiophene 5,5-dioxide (PubChem CID 130353621) has the molecular formula C56H46N2O2S and a molecular weight of 811.06 g/mol. Its IUPAC name is 3,7-bis[4-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2,3-dimethylphenyl]dibenzothiophene 5,5-dioxide.
| Compound Name | 3,7-bis[4-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2,3-dimethylphenyl]dibenzothiophene 5,5-dioxide |
|---|---|
| PubChem CID | 130353621 |
| Molecular Formula | C56H46N2O2S |
| Molecular Weight | 811.06 g/mol |
| Exact Mass | 810.33 |
| IUPAC Name | 3,7-bis[4-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2,3-dimethylphenyl]dibenzothiophene 5,5-dioxide |
| SMILES | Cc1c(-c2ccc3c(c2)S(=O)(=O)c2cc(-c4ccc(N5c6ccccc6CCc6ccccc65)c(C)c4C)ccc2-3)ccc(N2c3ccccc3CCc3ccccc32)c1C |
| InChI | InChI=1S/C56H46N2O2S/c1-35-37(3)49(57-51-17-9-5-13-39(51)21-22-40-14-6-10-18-52(40)57)31-29-45(35)43-25-27-47-48-28-26-44(34-56(48)61(59,60)55(47)33-43)46-30-32-50(38(4)36(46)2)58-53-19-11-7-15-41(53)23-24-42-16-8-12-20-54(42)58/h5-20,25-34H,21-24H2,1-4H3 |
| InChIKey | CJWIBGLVYJXWHI-UHFFFAOYSA-N |
| XLogP | 14.20 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.06 |
| LogP ≤ 5 | 14.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |