C23H27FN6O — CID 130354067
(8R,14S)-3-fluoro-19-methyl-7-oxa-10,16,19,23,24,27-hexazahexacyclo[18.5.2.12,6.18,16.010,14.023,26]nonacosa-1(26),2,4,6(29),20(27),21,24-heptaene (PubChem CID 130354067) has the molecular formula C23H27FN6O and a molecular weight of 422.51 g/mol. Its IUPAC name is (8R,14S)-3-fluoro-19-methyl-7-oxa-10,16,19,23,24,27-hexazahexacyclo[18.5.2.12,6.18,16.010,14.023,26]nonacosa-1(26),2,4,6(29),20(27),21,24-heptaene.
| Compound Name | (8R,14S)-3-fluoro-19-methyl-7-oxa-10,16,19,23,24,27-hexazahexacyclo[18.5.2.12,6.18,16.010,14.023,26]nonacosa-1(26),2,4,6(29),20(27),21,24-heptaene |
|---|---|
| PubChem CID | 130354067 |
| Molecular Formula | C23H27FN6O |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | (8R,14S)-3-fluoro-19-methyl-7-oxa-10,16,19,23,24,27-hexazahexacyclo[18.5.2.12,6.18,16.010,14.023,26]nonacosa-1(26),2,4,6(29),20(27),21,24-heptaene |
| SMILES | CN1CCN2C[C@H](CN3CCC[C@H]3C2)Oc2ccc(F)c(c2)-c2cnn3ccc1nc23 |
| InChI | InChI=1S/C23H27FN6O/c1-27-9-10-28-13-16-3-2-7-29(16)15-18(14-28)31-17-4-5-21(24)19(11-17)20-12-25-30-8-6-22(27)26-23(20)30/h4-6,8,11-12,16,18H,2-3,7,9-10,13-15H2,1H3/t16-,18+/m0/s1 |
| InChIKey | SWFYTWFKWTZELX-FUHWJXTLSA-N |
| XLogP | 2.51 |
| TPSA | 49.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |