C20H21FN4O — CID 130354069
(9S)-3-fluoro-7-oxa-13,20,21,24-tetrazapentacyclo[15.5.2.12,6.09,13.020,23]pentacosa-1(23),2,4,6(25),17(24),18,21-heptaene (PubChem CID 130354069) has the molecular formula C20H21FN4O and a molecular weight of 352.41 g/mol. Its IUPAC name is (9S)-3-fluoro-7-oxa-13,20,21,24-tetrazapentacyclo[15.5.2.12,6.09,13.020,23]pentacosa-1(23),2,4,6(25),17(24),18,21-heptaene.
| Compound Name | (9S)-3-fluoro-7-oxa-13,20,21,24-tetrazapentacyclo[15.5.2.12,6.09,13.020,23]pentacosa-1(23),2,4,6(25),17(24),18,21-heptaene |
|---|---|
| PubChem CID | 130354069 |
| Molecular Formula | C20H21FN4O |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (9S)-3-fluoro-7-oxa-13,20,21,24-tetrazapentacyclo[15.5.2.12,6.09,13.020,23]pentacosa-1(23),2,4,6(25),17(24),18,21-heptaene |
| SMILES | Fc1ccc2cc1-c1cnn3ccc(nc13)CCCN1CCC[C@H]1CO2 |
| InChI | InChI=1S/C20H21FN4O/c21-19-6-5-16-11-17(19)18-12-22-25-10-7-14(23-20(18)25)3-1-8-24-9-2-4-15(24)13-26-16/h5-7,10-12,15H,1-4,8-9,13H2/t15-/m0/s1 |
| InChIKey | NLIGUBYZOVYVMN-HNNXBMFYSA-N |
| XLogP | 3.32 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |