C19H28O2 — CID 130354377
5-[(1Z)-buta-1,3-dienyl]-3,4-ditert-butyl-6-ethenyl-3,4-dihydropyran-2-one (PubChem CID 130354377) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-3,4-ditert-butyl-6-ethenyl-3,4-dihydropyran-2-one.
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-3,4-ditert-butyl-6-ethenyl-3,4-dihydropyran-2-one |
|---|---|
| PubChem CID | 130354377 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-3,4-ditert-butyl-6-ethenyl-3,4-dihydropyran-2-one |
| SMILES | C=C/C=C\C1=C(C=C)OC(=O)C(C(C)(C)C)C1C(C)(C)C |
| InChI | InChI=1S/C19H28O2/c1-9-11-12-13-14(10-2)21-17(20)16(19(6,7)8)15(13)18(3,4)5/h9-12,15-16H,1-2H2,3-8H3/b12-11- |
| InChIKey | LXNKHHUVOWAJPP-QXMHVHEDSA-N |
| XLogP | 5.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|