C30H46O9S — CID 130354929
4-[(2S,4R)-6-[[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]butane-1,2-diol (PubChem CID 130354929) has the molecular formula C30H46O9S and a molecular weight of 582.76 g/mol. Its IUPAC name is 4-[(2S,4R)-6-[[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]butane-1,2-diol.
| Compound Name | 4-[(2S,4R)-6-[[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]butane-1,2-diol |
|---|---|
| PubChem CID | 130354929 |
| Molecular Formula | C30H46O9S |
| Molecular Weight | 582.76 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | 4-[(2S,4R)-6-[[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]butane-1,2-diol |
| SMILES | C=C1C(C[C@@H]2O[C@H](CC3COC(C)(C)O3)[C@H](OC)[C@H]2CS(=O)(=O)c2ccccc2)O[C@@H](CCC(O)CO)C[C@H]1C |
| InChI | InChI=1S/C30H46O9S/c1-19-13-22(12-11-21(32)16-31)37-26(20(19)2)15-27-25(18-40(33,34)24-9-7-6-8-10-24)29(35-5)28(38-27)14-23-17-36-30(3,4)39-23/h6-10,19,21-23,25-29,31-32H,2,11-18H2,1,3-5H3/t19-,21?,22+,23?,25+,26?,27+,28-,29-/m1/s1 |
| InChIKey | MGPJNXQHKSONHF-DGMZYWHUSA-N |
| XLogP | 3.27 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.76 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|