C48H33F6NO3 — CID 130354946
1-[4-[4-[3-[2,3-dimethyl-4-[4-(2,2,2-trifluoroacetyl)phenyl]phenyl]-5-furo[3,2-f]indol-7-ylphenyl]-2,3-dimethylphenyl]phenyl]-2,2,2-trifluoroethanone (PubChem CID 130354946) has the molecular formula C48H33F6NO3 and a molecular weight of 785.78 g/mol. Its IUPAC name is 1-[4-[4-[3-[2,3-dimethyl-4-[4-(2,2,2-trifluoroacetyl)phenyl]phenyl]-5-furo[3,2-f]indol-7-ylphenyl]-2,3-dimethylphenyl]phenyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[4-[4-[3-[2,3-dimethyl-4-[4-(2,2,2-trifluoroacetyl)phenyl]phenyl]-5-furo[3,2-f]indol-7-ylphenyl]-2,3-dimethylphenyl]phenyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 130354946 |
| Molecular Formula | C48H33F6NO3 |
| Molecular Weight | 785.78 g/mol |
| Exact Mass | 785.24 |
| IUPAC Name | 1-[4-[4-[3-[2,3-dimethyl-4-[4-(2,2,2-trifluoroacetyl)phenyl]phenyl]-5-furo[3,2-f]indol-7-ylphenyl]-2,3-dimethylphenyl]phenyl]-2,2,2-trifluoroethanone |
| SMILES | Cc1c(-c2ccc(C(=O)C(F)(F)F)cc2)ccc(-c2cc(-c3ccc(-c4ccc(C(=O)C(F)(F)F)cc4)c(C)c3C)cc(-n3ccc4cc5ccoc5cc43)c2)c1C |
| InChI | InChI=1S/C48H33F6NO3/c1-26-28(3)41(15-13-39(26)30-5-9-32(10-6-30)45(56)47(49,50)51)36-22-37(24-38(23-36)55-19-17-34-21-35-18-20-58-44(35)25-43(34)55)42-16-14-40(27(2)29(42)4)31-7-11-33(12-8-31)46(57)48(52,53)54/h5-25H,1-4H3 |
| InChIKey | HYQNFRYYTVSTTH-UHFFFAOYSA-N |
| XLogP | 13.77 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.78 |
| LogP ≤ 5 | 13.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |