C34H33F2N7O — CID 130355126
1-[(1R,2S,3S,4S)-7-benzyl-3-(3,4-difluorophenyl)-7-azabicyclo[2.2.1]heptan-2-yl]-3-[4-methyl-3-(1-methylpyrazol-4-yl)-1-phenylpyrazol-5-yl]urea (PubChem CID 130355126) has the molecular formula C34H33F2N7O and a molecular weight of 593.68 g/mol. Its IUPAC name is 1-[(1R,2S,3S,4S)-7-benzyl-3-(3,4-difluorophenyl)-7-azabicyclo[2.2.1]heptan-2-yl]-3-[4-methyl-3-(1-methylpyrazol-4-yl)-1-phenylpyrazol-5-yl]urea.
| Compound Name | 1-[(1R,2S,3S,4S)-7-benzyl-3-(3,4-difluorophenyl)-7-azabicyclo[2.2.1]heptan-2-yl]-3-[4-methyl-3-(1-methylpyrazol-4-yl)-1-phenylpyrazol-5-yl]urea |
|---|---|
| PubChem CID | 130355126 |
| Molecular Formula | C34H33F2N7O |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | 1-[(1R,2S,3S,4S)-7-benzyl-3-(3,4-difluorophenyl)-7-azabicyclo[2.2.1]heptan-2-yl]-3-[4-methyl-3-(1-methylpyrazol-4-yl)-1-phenylpyrazol-5-yl]urea |
| SMILES | Cc1c(-c2cnn(C)c2)nn(-c2ccccc2)c1NC(=O)N[C@H]1[C@H](c2ccc(F)c(F)c2)[C@@H]2CC[C@H]1N2Cc1ccccc1 |
| InChI | InChI=1S/C34H33F2N7O/c1-21-31(24-18-37-41(2)20-24)40-43(25-11-7-4-8-12-25)33(21)39-34(44)38-32-29-16-15-28(42(29)19-22-9-5-3-6-10-22)30(32)23-13-14-26(35)27(36)17-23/h3-14,17-18,20,28-30,32H,15-16,19H2,1-2H3,(H2,38,39,44)/t28-,29+,30+,32+/m0/s1 |
| InChIKey | HKMWBGPRWKKTPX-WQVJPNSGSA-N |
| XLogP | 6.18 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |