C31H35F2N7O2 — CID 130355192
1-[(1R,2S,3S,4S)-3-(3,4-difluorophenyl)-7-(3-methoxypropyl)-7-azabicyclo[2.2.1]heptan-2-yl]-3-[4-methyl-3-(1-methylpyrazol-4-yl)-1-phenylpyrazol-5-yl]urea (PubChem CID 130355192) has the molecular formula C31H35F2N7O2 and a molecular weight of 575.66 g/mol. Its IUPAC name is 1-[(1R,2S,3S,4S)-3-(3,4-difluorophenyl)-7-(3-methoxypropyl)-7-azabicyclo[2.2.1]heptan-2-yl]-3-[4-methyl-3-(1-methylpyrazol-4-yl)-1-phenylpyrazol-5-yl]urea.
| Compound Name | 1-[(1R,2S,3S,4S)-3-(3,4-difluorophenyl)-7-(3-methoxypropyl)-7-azabicyclo[2.2.1]heptan-2-yl]-3-[4-methyl-3-(1-methylpyrazol-4-yl)-1-phenylpyrazol-5-yl]urea |
|---|---|
| PubChem CID | 130355192 |
| Molecular Formula | C31H35F2N7O2 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | 1-[(1R,2S,3S,4S)-3-(3,4-difluorophenyl)-7-(3-methoxypropyl)-7-azabicyclo[2.2.1]heptan-2-yl]-3-[4-methyl-3-(1-methylpyrazol-4-yl)-1-phenylpyrazol-5-yl]urea |
| SMILES | COCCCN1[C@@H]2CC[C@H]1[C@@H](c1ccc(F)c(F)c1)[C@@H]2NC(=O)Nc1c(C)c(-c2cnn(C)c2)nn1-c1ccccc1 |
| InChI | InChI=1S/C31H35F2N7O2/c1-19-28(21-17-34-38(2)18-21)37-40(22-8-5-4-6-9-22)30(19)36-31(41)35-29-26-13-12-25(39(26)14-7-15-42-3)27(29)20-10-11-23(32)24(33)16-20/h4-6,8-11,16-18,25-27,29H,7,12-15H2,1-3H3,(H2,35,36,41)/t25-,26+,27+,29+/m0/s1 |
| InChIKey | UJMKLFYVMKTFAK-NFWVVERESA-N |
| XLogP | 5.02 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|