C27H33N5O3S — CID 130356174
1-[benzyl-[(1-propan-2-ylpyrazol-3-yl)methyl]sulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 130356174) has the molecular formula C27H33N5O3S and a molecular weight of 507.66 g/mol. Its IUPAC name is 1-[benzyl-[(1-propan-2-ylpyrazol-3-yl)methyl]sulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[benzyl-[(1-propan-2-ylpyrazol-3-yl)methyl]sulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 130356174 |
| Molecular Formula | C27H33N5O3S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 1-[benzyl-[(1-propan-2-ylpyrazol-3-yl)methyl]sulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | CC(C)n1ccc(CN(Cc2ccccc2)S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)n1 |
| InChI | InChI=1S/C27H33N5O3S/c1-19(2)32-15-14-23(29-32)18-31(17-20-8-4-3-5-9-20)36(34,35)30-27(33)28-26-24-12-6-10-21(24)16-22-11-7-13-25(22)26/h3-5,8-9,14-16,19H,6-7,10-13,17-18H2,1-2H3,(H2,28,30,33) |
| InChIKey | OMYOWIJTHZRDJB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |