C26H30F3N5O3S — CID 130356206
1-[cyclohexa-2,4-dien-1-ylmethyl-[[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methyl]sulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 130356206) has the molecular formula C26H30F3N5O3S and a molecular weight of 549.62 g/mol. Its IUPAC name is 1-[cyclohexa-2,4-dien-1-ylmethyl-[[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methyl]sulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[cyclohexa-2,4-dien-1-ylmethyl-[[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methyl]sulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 130356206 |
| Molecular Formula | C26H30F3N5O3S |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | 1-[cyclohexa-2,4-dien-1-ylmethyl-[[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methyl]sulfamoyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)N(Cc1ccn(CC(F)(F)F)n1)CC1C=CC=CC1 |
| InChI | InChI=1S/C26H30F3N5O3S/c27-26(28,29)17-33-13-12-21(31-33)16-34(15-18-6-2-1-3-7-18)38(36,37)32-25(35)30-24-22-10-4-8-19(22)14-20-9-5-11-23(20)24/h1-3,6,12-14,18H,4-5,7-11,15-17H2,(H2,30,32,35) |
| InChIKey | YNQZJFQOEOHOFY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |