C21H15F6N7S2 — CID 130356252
N-(2,2,2-trifluoroethyl)-4-[[2-[[4-(2,2,2-trifluoroethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]aniline (PubChem CID 130356252) has the molecular formula C21H15F6N7S2 and a molecular weight of 543.52 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethyl)-4-[[2-[[4-(2,2,2-trifluoroethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]aniline.
| Compound Name | N-(2,2,2-trifluoroethyl)-4-[[2-[[4-(2,2,2-trifluoroethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]aniline |
|---|---|
| PubChem CID | 130356252 |
| Molecular Formula | C21H15F6N7S2 |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | N-(2,2,2-trifluoroethyl)-4-[[2-[[4-(2,2,2-trifluoroethylamino)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]aniline |
| SMILES | FC(F)(F)CNc1ccc(/N=N/c2cc3sc(/N=N/c4ccc(NCC(F)(F)F)cc4)nc3s2)cc1 |
| InChI | InChI=1S/C21H15F6N7S2/c22-20(23,24)10-28-12-1-5-14(6-2-12)31-33-17-9-16-18(36-17)30-19(35-16)34-32-15-7-3-13(4-8-15)29-11-21(25,26)27/h1-9,28-29H,10-11H2/b33-31+,34-32+ |
| InChIKey | UIRALFCYKIWSBI-FMWAKIAMSA-N |
| XLogP | 9.14 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|