C7H4ClF5N2O — CID 130356888
5-chloro-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-4-carbaldehyde (PubChem CID 130356888) has the molecular formula C7H4ClF5N2O and a molecular weight of 262.56 g/mol. Its IUPAC name is 5-chloro-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-4-carbaldehyde.
| Compound Name | 5-chloro-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 130356888 |
| Molecular Formula | C7H4ClF5N2O |
| Molecular Weight | 262.56 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | 5-chloro-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazole-4-carbaldehyde |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c(C=O)c1Cl |
| InChI | InChI=1S/C7H4ClF5N2O/c1-15-5(8)3(2-16)4(14-15)6(9,10)7(11,12)13/h2H,1H3 |
| InChIKey | GIDNEBUPFKMOEB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.56 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|