C13H19F3N2O2 — CID 130357112
2,2,2-trifluoroethyl (2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidine-1-carboxylate (PubChem CID 130357112) has the molecular formula C13H19F3N2O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidine-1-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl (2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 130357112 |
| Molecular Formula | C13H19F3N2O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2,2,2-trifluoroethyl (2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidine-1-carboxylate |
| SMILES | CN1CC=C([C@@H]2CCCN2C(=O)OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H19F3N2O2/c1-17-7-4-10(5-8-17)11-3-2-6-18(11)12(19)20-9-13(14,15)16/h4,11H,2-3,5-9H2,1H3/t11-/m0/s1 |
| InChIKey | ZDBOOVBNTOSLJE-NSHDSACASA-N |
| XLogP | 2.41 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|