C26H35F6NO8S3 — CID 130357243
2-cyclohexyl-5-[4-[1-(1,1,2,2,3,3-hexafluoro-3-sulfopropyl)sulfonylpiperidin-3-yl]cyclohexyl]benzenesulfonic acid (PubChem CID 130357243) has the molecular formula C26H35F6NO8S3 and a molecular weight of 699.75 g/mol. Its IUPAC name is 2-cyclohexyl-5-[4-[1-(1,1,2,2,3,3-hexafluoro-3-sulfopropyl)sulfonylpiperidin-3-yl]cyclohexyl]benzenesulfonic acid.
| Compound Name | 2-cyclohexyl-5-[4-[1-(1,1,2,2,3,3-hexafluoro-3-sulfopropyl)sulfonylpiperidin-3-yl]cyclohexyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 130357243 |
| Molecular Formula | C26H35F6NO8S3 |
| Molecular Weight | 699.75 g/mol |
| Exact Mass | 699.14 |
| IUPAC Name | 2-cyclohexyl-5-[4-[1-(1,1,2,2,3,3-hexafluoro-3-sulfopropyl)sulfonylpiperidin-3-yl]cyclohexyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(C2CCC(C3CCCN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)C3)CC2)ccc1C1CCCCC1 |
| InChI | InChI=1S/C26H35F6NO8S3/c27-24(28,26(31,32)44(39,40)41)25(29,30)43(37,38)33-14-4-7-21(16-33)18-10-8-17(9-11-18)20-12-13-22(19-5-2-1-3-6-19)23(15-20)42(34,35)36/h12-13,15,17-19,21H,1-11,14,16H2,(H,34,35,36)(H,39,40,41) |
| InChIKey | APDSJJZFYVKULL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 146.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.75 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|