About 9-amino-6-benzyl-2,3-dihydroimidazo[1,2-c]quinazolin-5-one
9-amino-6-benzyl-2,3-dihydroimidazo[1,2-c]quinazolin-5-one (PubChem CID 13035742) has the molecular formula C17H16N4O
and a molecular weight of 292.34 g/mol. Its IUPAC name is 9-amino-6-benzyl-2,3-dihydroimidazo[1,2-c]quinazolin-5-one.
Molecular Properties
| Compound Name | 9-amino-6-benzyl-2,3-dihydroimidazo[1,2-c]quinazolin-5-one |
| PubChem CID | 13035742 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 9-amino-6-benzyl-2,3-dihydroimidazo[1,2-c]quinazolin-5-one |
| SMILES | Nc1ccc2c(c1)C1=NCCN1C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C17H16N4O/c18-13-6-7-15-14(10-13)16-19-8-9-20(16)17(22)21(15)11-12-4-2-1-3-5-12/h1-7,10H,8-9,11,18H2 |
| InChIKey | ZYOGPSALNDLKOM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9-amino-6-benzyl-2,3-dihydroimidazo[1,2-c]quinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-6-benzyl-2,3-dihydroimidazo[1,2-c]quinazolin-5-one?
The IUPAC name of 9-amino-6-benzyl-2,3-dihydroimidazo[1,2-c]quinazolin-5-one (CID 13035742) is 9-amino-6-benzyl-2,3-dihydroimidazo[1,2-c]quinazolin-5-one.
What is the SMILES notation for 9-amino-6-benzyl-2,3-dihydroimidazo[1,2-c]quinazolin-5-one?
The canonical SMILES for 9-amino-6-benzyl-2,3-dihydroimidazo[1,2-c]quinazolin-5-one is Nc1ccc2c(c1)C1=NCCN1C(=O)N2Cc1ccccc1.
What is the InChIKey of 9-amino-6-benzyl-2,3-dihydroimidazo[1,2-c]quinazolin-5-one?
The InChIKey is ZYOGPSALNDLKOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O/c18-13-6-7-15-14(10-13)16-19-8-9-20(16)17(22)21(15)11-12-4-2-1-3-5-12/h1-7,10H,8-9,11,18H2.
What are the key properties of 9-amino-6-benzyl-2,3-dihydroimidazo[1,2-c]quinazolin-5-one?
9-amino-6-benzyl-2,3-dihydroimidazo[1,2-c]quinazolin-5-one has a molecular weight of 292.34 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-6-benzyl-2,3-dihydroimidazo[1,2-c]quinazolin-5-one is sourced from PubChem (CID 13035742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).