C23H20N4OS — CID 130357685
5-benzyl-4-[2-(1,2-dihydropyridin-3-yl)ethynyl]-13-methyl-8-oxa-3-thia-1,11,12-triazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene (PubChem CID 130357685) has the molecular formula C23H20N4OS and a molecular weight of 400.51 g/mol. Its IUPAC name is 5-benzyl-4-[2-(1,2-dihydropyridin-3-yl)ethynyl]-13-methyl-8-oxa-3-thia-1,11,12-triazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene.
| Compound Name | 5-benzyl-4-[2-(1,2-dihydropyridin-3-yl)ethynyl]-13-methyl-8-oxa-3-thia-1,11,12-triazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene |
|---|---|
| PubChem CID | 130357685 |
| Molecular Formula | C23H20N4OS |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 5-benzyl-4-[2-(1,2-dihydropyridin-3-yl)ethynyl]-13-methyl-8-oxa-3-thia-1,11,12-triazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene |
| SMILES | Cc1nnc2n1-c1sc(C#CC3=CC=CNC3)c(Cc3ccccc3)c1COC2 |
| InChI | InChI=1S/C23H20N4OS/c1-16-25-26-22-15-28-14-20-19(12-17-6-3-2-4-7-17)21(29-23(20)27(16)22)10-9-18-8-5-11-24-13-18/h2-8,11,24H,12-15H2,1H3 |
| InChIKey | TWKGSAWBNFIRPF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|