C26H26F4N4O3 — CID 130357929
4-[3-[6-fluoro-4-(oxan-4-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxybenzamide (PubChem CID 130357929) has the molecular formula C26H26F4N4O3 and a molecular weight of 518.51 g/mol. Its IUPAC name is 4-[3-[6-fluoro-4-(oxan-4-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxybenzamide.
| Compound Name | 4-[3-[6-fluoro-4-(oxan-4-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxybenzamide |
|---|---|
| PubChem CID | 130357929 |
| Molecular Formula | C26H26F4N4O3 |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 4-[3-[6-fluoro-4-(oxan-4-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxybenzamide |
| SMILES | COc1cc(C(N)=O)ccc1NCC#Cc1cc2c(NC3CCOCC3)cc(F)cc2n1CC(F)(F)F |
| InChI | InChI=1S/C26H26F4N4O3/c1-36-24-11-16(25(31)35)4-5-21(24)32-8-2-3-19-14-20-22(33-18-6-9-37-10-7-18)12-17(27)13-23(20)34(19)15-26(28,29)30/h4-5,11-14,18,32-33H,6-10,15H2,1H3,(H2,31,35) |
| InChIKey | LQQXQCMXZNJLJX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|