C9H14N6OS — CID 130357955
(3aS,4S,6aR)-4-[(2H-triazol-4-ylmethylamino)methyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (PubChem CID 130357955) has the molecular formula C9H14N6OS and a molecular weight of 254.32 g/mol. Its IUPAC name is (3aS,4S,6aR)-4-[(2H-triazol-4-ylmethylamino)methyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | (3aS,4S,6aR)-4-[(2H-triazol-4-ylmethylamino)methyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 130357955 |
| Molecular Formula | C9H14N6OS |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (3aS,4S,6aR)-4-[(2H-triazol-4-ylmethylamino)methyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| SMILES | O=C1N[C@H]2[C@H](CS[C@H]2CNCc2cn[nH]n2)N1 |
| InChI | InChI=1S/C9H14N6OS/c16-9-12-6-4-17-7(8(6)13-9)3-10-1-5-2-11-15-14-5/h2,6-8,10H,1,3-4H2,(H,11,14,15)(H2,12,13,16)/t6-,7-,8-/m0/s1 |
| InChIKey | UTUSHDDNMUDICD-FXQIFTODSA-N |
| XLogP | -0.94 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|