About 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-(6-methyl-3-pyridinyl)benzoic acid
3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-(6-methyl-3-pyridinyl)benzoic acid (PubChem CID 130358206) has the molecular formula C17H15N3O4S2
and a molecular weight of 389.46 g/mol. Its IUPAC name is 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-(6-methyl-3-pyridinyl)benzoic acid.
Molecular Properties
| Compound Name | 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-(6-methyl-3-pyridinyl)benzoic acid |
| PubChem CID | 130358206 |
| Molecular Formula | C17H15N3O4S2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-(6-methyl-3-pyridinyl)benzoic acid |
| SMILES | Cc1ccc(-c2cc(C(=O)O)cc(S(=O)(=O)c3cnc(CN)s3)c2)cn1 |
| InChI | InChI=1S/C17H15N3O4S2/c1-10-2-3-11(8-19-10)12-4-13(17(21)22)6-14(5-12)26(23,24)16-9-20-15(7-18)25-16/h2-6,8-9H,7,18H2,1H3,(H,21,22) |
| InChIKey | BBNLOKMEQFBBPE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-(6-methyl-3-pyridinyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-(6-methyl-3-pyridinyl)benzoic acid?
The IUPAC name of 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-(6-methyl-3-pyridinyl)benzoic acid (CID 130358206) is 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-(6-methyl-3-pyridinyl)benzoic acid.
What is the SMILES notation for 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-(6-methyl-3-pyridinyl)benzoic acid?
The canonical SMILES for 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-(6-methyl-3-pyridinyl)benzoic acid is Cc1ccc(-c2cc(C(=O)O)cc(S(=O)(=O)c3cnc(CN)s3)c2)cn1.
What is the InChIKey of 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-(6-methyl-3-pyridinyl)benzoic acid?
The InChIKey is BBNLOKMEQFBBPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O4S2/c1-10-2-3-11(8-19-10)12-4-13(17(21)22)6-14(5-12)26(23,24)16-9-20-15(7-18)25-16/h2-6,8-9H,7,18H2,1H3,(H,21,22).
What are the key properties of 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-(6-methyl-3-pyridinyl)benzoic acid?
3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-(6-methyl-3-pyridinyl)benzoic acid has a molecular weight of 389.46 g/mol, XLogP of 2.50, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-(6-methyl-3-pyridinyl)benzoic acid is sourced from PubChem (CID 130358206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).