About (4-hydroxysulfanyl-1,3-thiazol-2-yl)methanamine
(4-hydroxysulfanyl-1,3-thiazol-2-yl)methanamine (PubChem CID 130358226) has the molecular formula C4H6N2OS2
and a molecular weight of 162.24 g/mol. Its IUPAC name is (4-hydroxysulfanyl-1,3-thiazol-2-yl)methanamine.
Molecular Properties
| Compound Name | (4-hydroxysulfanyl-1,3-thiazol-2-yl)methanamine |
| PubChem CID | 130358226 |
| Molecular Formula | C4H6N2OS2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 161.99 |
| IUPAC Name | (4-hydroxysulfanyl-1,3-thiazol-2-yl)methanamine |
| SMILES | NCc1nc(SO)cs1 |
| InChI | InChI=1S/C4H6N2OS2/c5-1-3-6-4(9-7)2-8-3/h2,7H,1,5H2 |
| InChIKey | PISYCEMJQFZHGE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxysulfanyl-1,3-thiazol-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxysulfanyl-1,3-thiazol-2-yl)methanamine?
The IUPAC name of (4-hydroxysulfanyl-1,3-thiazol-2-yl)methanamine (CID 130358226) is (4-hydroxysulfanyl-1,3-thiazol-2-yl)methanamine.
What is the SMILES notation for (4-hydroxysulfanyl-1,3-thiazol-2-yl)methanamine?
The canonical SMILES for (4-hydroxysulfanyl-1,3-thiazol-2-yl)methanamine is NCc1nc(SO)cs1.
What is the InChIKey of (4-hydroxysulfanyl-1,3-thiazol-2-yl)methanamine?
The InChIKey is PISYCEMJQFZHGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2OS2/c5-1-3-6-4(9-7)2-8-3/h2,7H,1,5H2.
What are the key properties of (4-hydroxysulfanyl-1,3-thiazol-2-yl)methanamine?
(4-hydroxysulfanyl-1,3-thiazol-2-yl)methanamine has a molecular weight of 162.24 g/mol, XLogP of 1.17, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxysulfanyl-1,3-thiazol-2-yl)methanamine is sourced from PubChem (CID 130358226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).