C30H48O10S — CID 130358887
(2S,5R)-10-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-methoxyoxolan-2-yl]-7-methyl-8-methylidenedecane-1,2,5,9-tetrol (PubChem CID 130358887) has the molecular formula C30H48O10S and a molecular weight of 600.77 g/mol. Its IUPAC name is (2S,5R)-10-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-methoxyoxolan-2-yl]-7-methyl-8-methylidenedecane-1,2,5,9-tetrol.
| Compound Name | (2S,5R)-10-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-methoxyoxolan-2-yl]-7-methyl-8-methylidenedecane-1,2,5,9-tetrol |
|---|---|
| PubChem CID | 130358887 |
| Molecular Formula | C30H48O10S |
| Molecular Weight | 600.77 g/mol |
| Exact Mass | 600.30 |
| IUPAC Name | (2S,5R)-10-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-methoxyoxolan-2-yl]-7-methyl-8-methylidenedecane-1,2,5,9-tetrol |
| SMILES | C=C(C(C)C[C@H](O)CC[C@H](O)CO)C(O)C[C@@H]1O[C@H](CC2COC(C)(C)O2)[C@H](OC)[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H48O10S/c1-19(13-21(32)11-12-22(33)16-31)20(2)26(34)15-27-25(18-41(35,36)24-9-7-6-8-10-24)29(37-5)28(39-27)14-23-17-38-30(3,4)40-23/h6-10,19,21-23,25-29,31-34H,2,11-18H2,1,3-5H3/t19?,21-,22+,23?,25+,26?,27+,28-,29-/m1/s1 |
| InChIKey | ZNRYLSJABNLNMO-TZIPWHHESA-N |
| XLogP | 2.23 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.77 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|