C26H38O7S — CID 130358975
(2R,4R)-2-[[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methoxyoxolan-2-yl]methyl]-4-methyl-3-methylideneoxane (PubChem CID 130358975) has the molecular formula C26H38O7S and a molecular weight of 494.65 g/mol. Its IUPAC name is (2R,4R)-2-[[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methoxyoxolan-2-yl]methyl]-4-methyl-3-methylideneoxane.
| Compound Name | (2R,4R)-2-[[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methoxyoxolan-2-yl]methyl]-4-methyl-3-methylideneoxane |
|---|---|
| PubChem CID | 130358975 |
| Molecular Formula | C26H38O7S |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | (2R,4R)-2-[[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methoxyoxolan-2-yl]methyl]-4-methyl-3-methylideneoxane |
| SMILES | C=C1[C@H](C)CCO[C@@H]1C[C@@H]1O[C@H](C[C@H]2COC(C)(C)O2)[C@H](OC)[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H38O7S/c1-17-11-12-30-22(18(17)2)14-23-21(16-34(27,28)20-9-7-6-8-10-20)25(29-5)24(32-23)13-19-15-31-26(3,4)33-19/h6-10,17,19,21-25H,2,11-16H2,1,3-5H3/t17-,19+,21+,22-,23+,24-,25-/m1/s1 |
| InChIKey | QYMNCMBBNBYSJA-GZSDZWGJSA-N |
| XLogP | 3.77 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|