C12H20F3N — CID 130359029
10,10,10-trifluoro-3,6-dimethyldecanenitrile (PubChem CID 130359029) has the molecular formula C12H20F3N and a molecular weight of 235.29 g/mol. Its IUPAC name is 10,10,10-trifluoro-3,6-dimethyldecanenitrile.
| Compound Name | 10,10,10-trifluoro-3,6-dimethyldecanenitrile |
|---|---|
| PubChem CID | 130359029 |
| Molecular Formula | C12H20F3N |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 10,10,10-trifluoro-3,6-dimethyldecanenitrile |
| SMILES | CC(CC#N)CCC(C)CCCC(F)(F)F |
| InChI | InChI=1S/C12H20F3N/c1-10(4-3-8-12(13,14)15)5-6-11(2)7-9-16/h10-11H,3-8H2,1-2H3 |
| InChIKey | GNQHFRRNANOENI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |