C12H20O4S2 — CID 130359489
methyl (2S,3R,4S,5S,6R)-6-(1,3-dithiolan-2-yl)-4-hydroxy-3,5-dimethyloxane-2-carboxylate (PubChem CID 130359489) has the molecular formula C12H20O4S2 and a molecular weight of 292.42 g/mol. Its IUPAC name is methyl (2S,3R,4S,5S,6R)-6-(1,3-dithiolan-2-yl)-4-hydroxy-3,5-dimethyloxane-2-carboxylate.
| Compound Name | methyl (2S,3R,4S,5S,6R)-6-(1,3-dithiolan-2-yl)-4-hydroxy-3,5-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 130359489 |
| Molecular Formula | C12H20O4S2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | methyl (2S,3R,4S,5S,6R)-6-(1,3-dithiolan-2-yl)-4-hydroxy-3,5-dimethyloxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](C2SCCS2)[C@@H](C)[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C12H20O4S2/c1-6-8(13)7(2)10(12-17-4-5-18-12)16-9(6)11(14)15-3/h6-10,12-13H,4-5H2,1-3H3/t6-,7+,8+,9+,10-/m1/s1 |
| InChIKey | RACNJBTVNUSKKU-SQQIUAQRSA-N |
| XLogP | 1.37 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |