C20H19ClF2N4O2 — CID 130359743
(3R)-N-[5-chloro-3-(3,3-difluorocyclobutyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-phenylbutanamide (PubChem CID 130359743) has the molecular formula C20H19ClF2N4O2 and a molecular weight of 420.85 g/mol. Its IUPAC name is (3R)-N-[5-chloro-3-(3,3-difluorocyclobutyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-phenylbutanamide.
| Compound Name | (3R)-N-[5-chloro-3-(3,3-difluorocyclobutyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-phenylbutanamide |
|---|---|
| PubChem CID | 130359743 |
| Molecular Formula | C20H19ClF2N4O2 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | (3R)-N-[5-chloro-3-(3,3-difluorocyclobutyl)imidazo[4,5-b]pyridin-2-yl]-3-hydroxy-3-phenylbutanamide |
| SMILES | C[C@@](O)(CC(=O)Nc1nc2ccc(Cl)nc2n1C1CC(F)(F)C1)c1ccccc1 |
| InChI | InChI=1S/C20H19ClF2N4O2/c1-19(29,12-5-3-2-4-6-12)11-16(28)26-18-24-14-7-8-15(21)25-17(14)27(18)13-9-20(22,23)10-13/h2-8,13,29H,9-11H2,1H3,(H,24,26,28)/t19-/m1/s1 |
| InChIKey | SLKDEAMXFDPUFU-LJQANCHMSA-N |
| XLogP | 4.29 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|