C17H26O4S — CID 130360522
(2R,3R,4S,5S,6S)-1-(benzenesulfonyl)-2,4,6-trimethyloct-7-ene-3,5-diol (PubChem CID 130360522) has the molecular formula C17H26O4S and a molecular weight of 326.46 g/mol. Its IUPAC name is (2R,3R,4S,5S,6S)-1-(benzenesulfonyl)-2,4,6-trimethyloct-7-ene-3,5-diol.
| Compound Name | (2R,3R,4S,5S,6S)-1-(benzenesulfonyl)-2,4,6-trimethyloct-7-ene-3,5-diol |
|---|---|
| PubChem CID | 130360522 |
| Molecular Formula | C17H26O4S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (2R,3R,4S,5S,6S)-1-(benzenesulfonyl)-2,4,6-trimethyloct-7-ene-3,5-diol |
| SMILES | C=C[C@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H26O4S/c1-5-12(2)16(18)14(4)17(19)13(3)11-22(20,21)15-9-7-6-8-10-15/h5-10,12-14,16-19H,1,11H2,2-4H3/t12-,13-,14-,16-,17-/m0/s1 |
| InChIKey | YKLRLTQZEMHZRF-JBJRXJHCSA-N |
| XLogP | 2.28 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|