C9H13NO3 — CID 130360675
[(7S,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl] formate (PubChem CID 130360675) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is [(7S,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl] formate.
| Compound Name | [(7S,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl] formate |
|---|---|
| PubChem CID | 130360675 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | [(7S,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl] formate |
| SMILES | O=CO[C@H]1CCN2C(=O)CC[C@H]2C1 |
| InChI | InChI=1S/C9H13NO3/c11-6-13-8-3-4-10-7(5-8)1-2-9(10)12/h6-8H,1-5H2/t7-,8-/m0/s1 |
| InChIKey | BALACVMRXUZEIA-YUMQZZPRSA-N |
| XLogP | 0.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|