C11H22O3 — CID 130360949
cis-(1R,2S)-2,4-dimethoxy-3,5-dimethylcycloheptan-1-ol (PubChem CID 130360949) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is cis-(1R,2S)-2,4-dimethoxy-3,5-dimethylcycloheptan-1-ol.
| Compound Name | cis-(1R,2S)-2,4-dimethoxy-3,5-dimethylcycloheptan-1-ol |
|---|---|
| PubChem CID | 130360949 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | cis-(1R,2S)-2,4-dimethoxy-3,5-dimethylcycloheptan-1-ol |
| SMILES | COC1C(C)CC[C@@H](O)[C@@H](OC)C1C |
| InChI | InChI=1S/C11H22O3/c1-7-5-6-9(12)11(14-4)8(2)10(7)13-3/h7-12H,5-6H2,1-4H3/t7?,8?,9-,10?,11+/m1/s1 |
| InChIKey | OBPJVTAEKJBARF-SDBDODODSA-N |
| XLogP | 1.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |