About (8R)-9-(1,1-dimethoxyethyl)-8-methylspiro[4.5]decane
(8R)-9-(1,1-dimethoxyethyl)-8-methylspiro[4.5]decane (PubChem CID 130361478) has the molecular formula C15H28O2
and a molecular weight of 240.39 g/mol. Its IUPAC name is (8R)-9-(1,1-dimethoxyethyl)-8-methylspiro[4.5]decane.
Molecular Properties
| Compound Name | (8R)-9-(1,1-dimethoxyethyl)-8-methylspiro[4.5]decane |
| PubChem CID | 130361478 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (8R)-9-(1,1-dimethoxyethyl)-8-methylspiro[4.5]decane |
| SMILES | COC(C)(OC)C1CC2(CCCC2)CC[C@H]1C |
| InChI | InChI=1S/C15H28O2/c1-12-7-10-15(8-5-6-9-15)11-13(12)14(2,16-3)17-4/h12-13H,5-11H2,1-4H3/t12-,13?/m1/s1 |
| InChIKey | UTGXKJSKDOMJCJ-PZORYLMUSA-N |
| XLogP | 3.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (8R)-9-(1,1-dimethoxyethyl)-8-methylspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8R)-9-(1,1-dimethoxyethyl)-8-methylspiro[4.5]decane?
The IUPAC name of (8R)-9-(1,1-dimethoxyethyl)-8-methylspiro[4.5]decane (CID 130361478) is (8R)-9-(1,1-dimethoxyethyl)-8-methylspiro[4.5]decane.
What is the SMILES notation for (8R)-9-(1,1-dimethoxyethyl)-8-methylspiro[4.5]decane?
The canonical SMILES for (8R)-9-(1,1-dimethoxyethyl)-8-methylspiro[4.5]decane is COC(C)(OC)C1CC2(CCCC2)CC[C@H]1C.
What is the InChIKey of (8R)-9-(1,1-dimethoxyethyl)-8-methylspiro[4.5]decane?
The InChIKey is UTGXKJSKDOMJCJ-PZORYLMUSA-N. The full InChI is InChI=1S/C15H28O2/c1-12-7-10-15(8-5-6-9-15)11-13(12)14(2,16-3)17-4/h12-13H,5-11H2,1-4H3/t12-,13?/m1/s1.
What are the key properties of (8R)-9-(1,1-dimethoxyethyl)-8-methylspiro[4.5]decane?
(8R)-9-(1,1-dimethoxyethyl)-8-methylspiro[4.5]decane has a molecular weight of 240.39 g/mol, XLogP of 3.99, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (8R)-9-(1,1-dimethoxyethyl)-8-methylspiro[4.5]decane is sourced from PubChem (CID 130361478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).