C32H41F3N4O4 — CID 130361550
2-[2-[2-[4-[[2-[3-(2-methoxy-4-methylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]ethoxy]ethoxy]ethanol (PubChem CID 130361550) has the molecular formula C32H41F3N4O4 and a molecular weight of 602.70 g/mol. Its IUPAC name is 2-[2-[2-[4-[[2-[3-(2-methoxy-4-methylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[4-[[2-[3-(2-methoxy-4-methylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 130361550 |
| Molecular Formula | C32H41F3N4O4 |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | 2-[2-[2-[4-[[2-[3-(2-methoxy-4-methylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]ethoxy]ethoxy]ethanol |
| SMILES | COc1cc(C)ccc1NCC#Cc1cc2c(NC3CCN(CCOCCOCCO)CC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C32H41F3N4O4/c1-24-8-9-29(31(21-24)41-2)36-12-4-5-26-22-27-28(6-3-7-30(27)39(26)23-32(33,34)35)37-25-10-13-38(14-11-25)15-17-42-19-20-43-18-16-40/h3,6-9,21-22,25,36-37,40H,10-20,23H2,1-2H3 |
| InChIKey | JCVMNDNUNHDJMB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|