C38H54N2O2 — CID 130361690
methyl (2E,4Z)-4-[(E)-1-[2-(4-methylphenyl)ethyl-[(Z)-1-[methyl-[(2Z,3Z,5Z)-2-propylidenehepta-3,5-dienyl]amino]but-2-en-2-yl]amino]prop-1-enyl]-2-[(Z)-prop-1-enyl]hepta-2,4-dienoate (PubChem CID 130361690) has the molecular formula C38H54N2O2 and a molecular weight of 570.86 g/mol. Its IUPAC name is methyl (2E,4Z)-4-[(E)-1-[2-(4-methylphenyl)ethyl-[(Z)-1-[methyl-[(2Z,3Z,5Z)-2-propylidenehepta-3,5-dienyl]amino]but-2-en-2-yl]amino]prop-1-enyl]-2-[(Z)-prop-1-enyl]hepta-2,4-dienoate.
| Compound Name | methyl (2E,4Z)-4-[(E)-1-[2-(4-methylphenyl)ethyl-[(Z)-1-[methyl-[(2Z,3Z,5Z)-2-propylidenehepta-3,5-dienyl]amino]but-2-en-2-yl]amino]prop-1-enyl]-2-[(Z)-prop-1-enyl]hepta-2,4-dienoate |
|---|---|
| PubChem CID | 130361690 |
| Molecular Formula | C38H54N2O2 |
| Molecular Weight | 570.86 g/mol |
| Exact Mass | 570.42 |
| IUPAC Name | methyl (2E,4Z)-4-[(E)-1-[2-(4-methylphenyl)ethyl-[(Z)-1-[methyl-[(2Z,3Z,5Z)-2-propylidenehepta-3,5-dienyl]amino]but-2-en-2-yl]amino]prop-1-enyl]-2-[(Z)-prop-1-enyl]hepta-2,4-dienoate |
| SMILES | C/C=C\C=C/C(=C/CC)CN(C)C/C(=C/C)N(CCc1ccc(C)cc1)C(=C/C)/C(=C\CC)/C=C(\C=C/C)C(=O)OC |
| InChI | InChI=1S/C38H54N2O2/c1-10-16-17-21-33(18-11-2)29-39(8)30-36(14-5)40(27-26-32-24-22-31(7)23-25-32)37(15-6)34(19-12-3)28-35(20-13-4)38(41)42-9/h10,13-25,28H,11-12,26-27,29-30H2,1-9H3/b16-10-,20-13-,21-17-,33-18-,34-19-,35-28+,36-14-,37-15+ |
| InChIKey | WAGQDFBMHNYLDO-FHHMOABVSA-N |
| XLogP | 9.06 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.86 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|