C25H17F4N3O2 — CID 130362279
3-fluoro-4-(1-prop-2-enoyl-2,3-dihydroindol-6-yl)-7-(trifluoromethyl)-9H-carbazole-1-carboxamide (PubChem CID 130362279) has the molecular formula C25H17F4N3O2 and a molecular weight of 467.42 g/mol. Its IUPAC name is 3-fluoro-4-(1-prop-2-enoyl-2,3-dihydroindol-6-yl)-7-(trifluoromethyl)-9H-carbazole-1-carboxamide.
| Compound Name | 3-fluoro-4-(1-prop-2-enoyl-2,3-dihydroindol-6-yl)-7-(trifluoromethyl)-9H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 130362279 |
| Molecular Formula | C25H17F4N3O2 |
| Molecular Weight | 467.42 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 3-fluoro-4-(1-prop-2-enoyl-2,3-dihydroindol-6-yl)-7-(trifluoromethyl)-9H-carbazole-1-carboxamide |
| SMILES | C=CC(=O)N1CCc2ccc(-c3c(F)cc(C(N)=O)c4[nH]c5cc(C(F)(F)F)ccc5c34)cc21 |
| InChI | InChI=1S/C25H17F4N3O2/c1-2-20(33)32-8-7-12-3-4-13(9-19(12)32)21-17(26)11-16(24(30)34)23-22(21)15-6-5-14(25(27,28)29)10-18(15)31-23/h2-6,9-11,31H,1,7-8H2,(H2,30,34) |
| InChIKey | LNLXLPQVMANOIH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.42 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|