C25H34F3NO5S3 — CID 130362375
(3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl) trifluoromethanesulfonate (PubChem CID 130362375) has the molecular formula C25H34F3NO5S3 and a molecular weight of 581.74 g/mol. Its IUPAC name is (3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl) trifluoromethanesulfonate.
| Compound Name | (3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 130362375 |
| Molecular Formula | C25H34F3NO5S3 |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | (3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl) trifluoromethanesulfonate |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(SC)c(OS(=O)(=O)C(F)(F)F)cc2S(O)(O)C1 |
| InChI | InChI=1S/C25H34F3NO5S3/c1-4-6-13-24(14-7-5-2)17-29(19-11-9-8-10-12-19)20-15-22(35-3)21(16-23(20)36(30,31)18-24)34-37(32,33)25(26,27)28/h8-12,15-16,30-31H,4-7,13-14,17-18H2,1-3H3 |
| InChIKey | AHALFFYVLDTQAQ-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|