About 4-[(2-ethenyl-1,3-thiazol-5-yl)methyl]-3-fluoro-9H-carbazole-1-carboxamide
4-[(2-ethenyl-1,3-thiazol-5-yl)methyl]-3-fluoro-9H-carbazole-1-carboxamide (PubChem CID 130362402) has the molecular formula C19H14FN3OS
and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-[(2-ethenyl-1,3-thiazol-5-yl)methyl]-3-fluoro-9H-carbazole-1-carboxamide.
Molecular Properties
| Compound Name | 4-[(2-ethenyl-1,3-thiazol-5-yl)methyl]-3-fluoro-9H-carbazole-1-carboxamide |
| PubChem CID | 130362402 |
| Molecular Formula | C19H14FN3OS |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 4-[(2-ethenyl-1,3-thiazol-5-yl)methyl]-3-fluoro-9H-carbazole-1-carboxamide |
| SMILES | C=Cc1ncc(Cc2c(F)cc(C(N)=O)c3[nH]c4ccccc4c23)s1 |
| InChI | InChI=1S/C19H14FN3OS/c1-2-16-22-9-10(25-16)7-12-14(20)8-13(19(21)24)18-17(12)11-5-3-4-6-15(11)23-18/h2-6,8-9,23H,1,7H2,(H2,21,24) |
| InChIKey | RZIZHKJPLKYLSD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(2-ethenyl-1,3-thiazol-5-yl)methyl]-3-fluoro-9H-carbazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-ethenyl-1,3-thiazol-5-yl)methyl]-3-fluoro-9H-carbazole-1-carboxamide?
The IUPAC name of 4-[(2-ethenyl-1,3-thiazol-5-yl)methyl]-3-fluoro-9H-carbazole-1-carboxamide (CID 130362402) is 4-[(2-ethenyl-1,3-thiazol-5-yl)methyl]-3-fluoro-9H-carbazole-1-carboxamide.
What is the SMILES notation for 4-[(2-ethenyl-1,3-thiazol-5-yl)methyl]-3-fluoro-9H-carbazole-1-carboxamide?
The canonical SMILES for 4-[(2-ethenyl-1,3-thiazol-5-yl)methyl]-3-fluoro-9H-carbazole-1-carboxamide is C=Cc1ncc(Cc2c(F)cc(C(N)=O)c3[nH]c4ccccc4c23)s1.
What is the InChIKey of 4-[(2-ethenyl-1,3-thiazol-5-yl)methyl]-3-fluoro-9H-carbazole-1-carboxamide?
The InChIKey is RZIZHKJPLKYLSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14FN3OS/c1-2-16-22-9-10(25-16)7-12-14(20)8-13(19(21)24)18-17(12)11-5-3-4-6-15(11)23-18/h2-6,8-9,23H,1,7H2,(H2,21,24).
What are the key properties of 4-[(2-ethenyl-1,3-thiazol-5-yl)methyl]-3-fluoro-9H-carbazole-1-carboxamide?
4-[(2-ethenyl-1,3-thiazol-5-yl)methyl]-3-fluoro-9H-carbazole-1-carboxamide has a molecular weight of 351.41 g/mol, XLogP of 4.25, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-ethenyl-1,3-thiazol-5-yl)methyl]-3-fluoro-9H-carbazole-1-carboxamide is sourced from PubChem (CID 130362402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).