C23H22ClFN4O2 — CID 130362458
6-chloro-3-fluoro-4-(1-prop-2-enoyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)-9H-carbazole-1-carboxamide (PubChem CID 130362458) has the molecular formula C23H22ClFN4O2 and a molecular weight of 440.91 g/mol. Its IUPAC name is 6-chloro-3-fluoro-4-(1-prop-2-enoyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)-9H-carbazole-1-carboxamide.
| Compound Name | 6-chloro-3-fluoro-4-(1-prop-2-enoyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)-9H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 130362458 |
| Molecular Formula | C23H22ClFN4O2 |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 6-chloro-3-fluoro-4-(1-prop-2-enoyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)-9H-carbazole-1-carboxamide |
| SMILES | C=CC(=O)N1CCCC2CN(c3c(F)cc(C(N)=O)c4[nH]c5ccc(Cl)cc5c34)CC21 |
| InChI | InChI=1S/C23H22ClFN4O2/c1-2-19(30)29-7-3-4-12-10-28(11-18(12)29)22-16(25)9-15(23(26)31)21-20(22)14-8-13(24)5-6-17(14)27-21/h2,5-6,8-9,12,18,27H,1,3-4,7,10-11H2,(H2,26,31) |
| InChIKey | FCFAWSXCTCBSBZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|