C16H19N3O2 — CID 130362581
8,8-dimethyl-5,6,7,9-tetrahydrocarbazole-1,7-dicarboxamide (PubChem CID 130362581) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 8,8-dimethyl-5,6,7,9-tetrahydrocarbazole-1,7-dicarboxamide.
| Compound Name | 8,8-dimethyl-5,6,7,9-tetrahydrocarbazole-1,7-dicarboxamide |
|---|---|
| PubChem CID | 130362581 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 8,8-dimethyl-5,6,7,9-tetrahydrocarbazole-1,7-dicarboxamide |
| SMILES | CC1(C)c2[nH]c3c(C(N)=O)cccc3c2CCC1C(N)=O |
| InChI | InChI=1S/C16H19N3O2/c1-16(2)11(15(18)21)7-6-9-8-4-3-5-10(14(17)20)12(8)19-13(9)16/h3-5,11,19H,6-7H2,1-2H3,(H2,17,20)(H2,18,21) |
| InChIKey | XSZGUVZHLPAUIK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 101.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |